4-Methyl-1H-imidazole-2-carboxaldehyde
Catalog No: FT-0648352
CAS No: 113825-16-4
- Chemical Name: 4-Methyl-1H-imidazole-2-carboxaldehyde
- Molecular Formula: C5H6N2O
- Molecular Weight: 110.11
- InChI Key: AEYQOYLTLFOCHR-UHFFFAOYSA-N
- InChI: InChI=1S/C5H6N2O/c1-4-2-6-5(3-8)7-4/h2-3H,1H3,(H,6,7)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 110.11400 |
| Density: | 1.238g/cm3 |
| CAS: | 113825-16-4 |
| Bolling_Point: | 298.8ºC at 760 mmHg |
| Product_Name: | 4-Methyl-1H-imidazole-2-carbaldehyde |
| Melting_Point: | N/A |
| Flash_Point: | 139ºC |
| MF: | C5H6N2O |
| Density: | 1.238g/cm3 |
|---|---|
| LogP: | 0.53060 |
| Flash_Point: | 139ºC |
| Refractive_Index: | 1.598 |
| FW: | 110.11400 |
| PSA: | 45.75000 |
| MF: | C5H6N2O |
| Bolling_Point: | 298.8ºC at 760 mmHg |
| Vapor_Pressure: | 0.00124mmHg at 25°C |
| Exact_Mass: | 110.04800 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933290090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)